| Compound Info | |||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|
| NAs | Base Info | ||||||||||
| ID | Cluster | Name | Target | MolWt | |||||||
|
NAs.001741 | 4 |
|
652.403 | |||||||
| Chemical Representations | |
|---|---|
| InChI | InChI=1S/C20H26N6O15P2/c21-17-11-19(24-5-23-17)26(6-25-11)20-15(30)13(28)10(40-20)4-38-43(34,35)41-42(32,33)37-3-9-12(27)14(29)16(39-9)8-1-7(2-36-8)18(22)31/h1-2,5-6,9-10,12-16,20,27-30H,3-4H2,(H2,22,31)(H,32,33)(H,34,35)(H2,21,23,24)/t9-,10-,12-,13-,14-,15-,16+,20-/m1/s1 |
| InChI Key | ZDPNWKLPQYGRKA-OFBRYVQJSA-N |
| SMILES | NC(=O)c1coc([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3O)[C@@H](O)[C@H]2O)c1 |
| Molecular Formula | C20H26N6O15P2 |
| Functional Fragments | ||
|---|---|---|
| Base | Ribose | Phosphate |
Match
|
Match
|
|
| Calculated Properties | ||
|---|---|---|
| logP | -2.168 | Computed by RDKit |
| Heavy Atom Count | 43 | Computed by RDKit |
| Ring Count | 5 | Computed by RDKit |
| Hydrogen Bond Acceptor Count | 18 | Computed by RDKit |
| Hydrogen Bond Donor Count | 8 | Computed by RDKit |
| Rotatable Bond Count | 11 | Computed by RDKit |
| Topological Polar Surface Area | 327.520 | Computed by RDKit |
| Activity Data | ||||||
|---|---|---|---|---|---|---|
| Target | Activity type | Relation | Value | Unit | Assay | Source |
| Inosine-5'-monophosphate dehydrogenase 1 | Ki | = | 37970.0 | nM | The compound was tested for the inhibition towards IMP(Inosine 5'-monophosphate) substrate of Inosine-5'-monophosphate dehydrogenase 1 | CHEMBL1131220 |
| Inosine-5'-monophosphate dehydrogenase 1 | Ki | = | 135120.0 | nM | The compound was tested for the inhibition towards NMD (Nicotinamide adenine dinucleotide) substrate of Inosine-5'-monophosphate dehydrogenase 1 | CHEMBL1131220 |
| Inosine-5'-monophosphate dehydrogenase 2 | Ki | = | 57900.0 | nM | The compound was tested for the inhibition towards IMP(Inosine 5'-monophosphate) substrate of Inosine-5'-monophosphate dehydrogenase 2 | CHEMBL1131220 |
| Inosine-5'-monophosphate dehydrogenase 2 | Ki | = | 99100.0 | nM | The compound was tested for the inhibition towards NMD (Nicotinamide adenine dinucleotide) substrate of Inosine-5'-monophosphate dehydrogenase 2 | CHEMBL1131220 |