| Compound Info | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NAs | Base Info | ||||||||||||
| ID | Cluster | Name | Target | MolWt | |||||||||
|
NAs.003854 | 0 |
|
513.201 | |||||||||
| Chemical Representations | |
|---|---|
| InChI | InChI=1S/C11H19FN3O13P3/c1-2-11(5-25-30(21,22)28-31(23,24)27-29(18,19)20)8(16)7(12)9(26-11)15-4-3-6(13)14-10(15)17/h3-4,7-9,16H,2,5H2,1H3,(H,21,22)(H,23,24)(H2,13,14,17)(H2,18,19,20)/t7-,8+,9-,11-/m1/s1 |
| InChI Key | UUHXVZFVVDXRGX-PKIKSRDPSA-N |
| SMILES | CC[C@]1(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@@H](n2ccc(N)nc2=O)[C@H](F)[C@@H]1O |
| Molecular Formula | C11H19FN3O13P3 |
| Functional Fragments | ||
|---|---|---|
| Base | Ribose | Phosphate |
Match
|
Match
|
|
| Calculated Properties | ||
|---|---|---|
| logP | -0.455 | Computed by RDKit |
| Heavy Atom Count | 31 | Computed by RDKit |
| Ring Count | 2 | Computed by RDKit |
| Hydrogen Bond Acceptor Count | 12 | Computed by RDKit |
| Hydrogen Bond Donor Count | 6 | Computed by RDKit |
| Rotatable Bond Count | 9 | Computed by RDKit |
| Topological Polar Surface Area | 250.190 | Computed by RDKit |
| Activity Data | ||||||
|---|---|---|---|---|---|---|
| Target | Activity type | Relation | Value | Unit | Assay | Source |
| DNA-directed RNA polymerase, mitochondrial | Inhibition | % | Inhibition of human mitochondrial RNA polymerase assessed as 13-mer product using [33P]RNA/DNA primer/templates used by agarose gel electrophoresis | CHEMBL3414561 | ||
| Unchecked | Inhibition | < | 50.0 | % | Inhibition of human DNA-directed RNA polymerase 2 using cytomegalovirus DNA fragment as substrate | CHEMBL3414561 |
| Unchecked | Inhibition | < | 50.0 | % | Inhibition of human DNA-dependent DNA polymerase gamma using calf thymus DNA/[3H]dTTP as substrate by microplate scintillation reader | CHEMBL3414561 |
| DNA polymerase beta | Inhibition | < | 50.0 | % | Inhibition of human DNA-dependent DNA polymerase beta using calf thymus DNA/[3H]dTTP as substrate by microplate scintillation reader | CHEMBL3414561 |
| Unchecked | Inhibition | < | 50.0 | % | Inhibition of human DNA-dependent DNA polymerase alpha using calf thymus DNA/[3H]dTTP as substrate by microplate scintillation reader | CHEMBL3414561 |
| Unchecked | IC50 | = | 150.0 | nM | Inhibition of Respiratory syncytial virus RNA polymerase in crude RSV RNP complex assessed as inhibition of [33P]CMP incorporation into RNA chain | CHEMBL3414561 |